C33H44O11Si — CID 170518361
[(3R,4S,6S)-3,4,5-triacetyloxy-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 170518361) has the molecular formula C33H44O11Si and a molecular weight of 644.79 g/mol. Its IUPAC name is [(3R,4S,6S)-3,4,5-triacetyloxy-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6S)-3,4,5-triacetyloxy-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 170518361 |
| Molecular Formula | C33H44O11Si |
| Molecular Weight | 644.79 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | [(3R,4S,6S)-3,4,5-triacetyloxy-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](O[C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H44O11Si/c1-21(19-39-45(33(6,7)8,26-15-11-9-12-16-26)27-17-13-10-14-18-27)40-32-31(43-25(5)37)30(42-24(4)36)29(41-23(3)35)28(44-32)20-38-22(2)34/h9-18,21,28-32H,19-20H2,1-8H3/t21-,28?,29-,30+,31?,32+/m1/s1 |
| InChIKey | QQSZRKCMFHLVLI-BAOCKZRXSA-N |
| XLogP | 3.05 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|