C49H33BN4 — CID 170518510
9-(3-phenylphenyl)-17-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-1-aza-14-boratetracyclo[12.4.0.02,7.08,13]octadeca-2,4,6,8(13),9,11,15,17-octaene (PubChem CID 170518510) has the molecular formula C49H33BN4 and a molecular weight of 688.64 g/mol. Its IUPAC name is 9-(3-phenylphenyl)-17-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-1-aza-14-boratetracyclo[12.4.0.02,7.08,13]octadeca-2,4,6,8(13),9,11,15,17-octaene.
| Compound Name | 9-(3-phenylphenyl)-17-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-1-aza-14-boratetracyclo[12.4.0.02,7.08,13]octadeca-2,4,6,8(13),9,11,15,17-octaene |
|---|---|
| PubChem CID | 170518510 |
| Molecular Formula | C49H33BN4 |
| Molecular Weight | 688.64 g/mol |
| Exact Mass | 688.28 |
| IUPAC Name | 9-(3-phenylphenyl)-17-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-1-aza-14-boratetracyclo[12.4.0.02,7.08,13]octadeca-2,4,6,8(13),9,11,15,17-octaene |
| SMILES | C1=CC(c2nc(-c3ccccc3)nc(-c3cccc(-c4ccccc4)c3)n2)=CN2B1c1cccc(-c3cccc(-c4ccccc4)c3)c1-c1ccccc12 |
| InChI | InChI=1S/C49H33BN4/c1-4-15-34(16-5-1)37-21-12-23-39(31-37)42-26-14-27-44-46(42)43-25-10-11-28-45(43)54-33-41(29-30-50(44)54)49-52-47(36-19-8-3-9-20-36)51-48(53-49)40-24-13-22-38(32-40)35-17-6-2-7-18-35/h1-33H |
| InChIKey | TUOHQAIBVKORRD-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.64 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|