About 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide
2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide (PubChem CID 170519099) has the molecular formula C13H19FN4O2
and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide |
| PubChem CID | 170519099 |
| Molecular Formula | C13H19FN4O2 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1nn(C)c(C)c1CC(=O)N1CCCC1(F)C(N)=O |
| InChI | InChI=1S/C13H19FN4O2/c1-8-10(9(2)17(3)16-8)7-11(19)18-6-4-5-13(18,14)12(15)20/h4-7H2,1-3H3,(H2,15,20) |
| InChIKey | DQFRAFYTUHBXJP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide?
The IUPAC name of 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide (CID 170519099) is 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide.
What is the SMILES notation for 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide?
The canonical SMILES for 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide is Cc1nn(C)c(C)c1CC(=O)N1CCCC1(F)C(N)=O.
What is the InChIKey of 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide?
The InChIKey is DQFRAFYTUHBXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN4O2/c1-8-10(9(2)17(3)16-8)7-11(19)18-6-4-5-13(18,14)12(15)20/h4-7H2,1-3H3,(H2,15,20).
What are the key properties of 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide?
2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide has a molecular weight of 282.32 g/mol, XLogP of 0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]pyrrolidine-2-carboxamide is sourced from PubChem (CID 170519099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).