C56H52BNO — CID 170519550
5,11-ditert-butyl-20-dibenzofuran-2-yl-16-(9,9-dimethylfluoren-3-yl)-8,8-dimethyl-1-aza-20-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2(7),3,5,9,11,13(21),14(19),15,17-nonaene (PubChem CID 170519550) has the molecular formula C56H52BNO and a molecular weight of 765.85 g/mol. Its IUPAC name is 5,11-ditert-butyl-20-dibenzofuran-2-yl-16-(9,9-dimethylfluoren-3-yl)-8,8-dimethyl-1-aza-20-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2(7),3,5,9,11,13(21),14(19),15,17-nonaene.
| Compound Name | 5,11-ditert-butyl-20-dibenzofuran-2-yl-16-(9,9-dimethylfluoren-3-yl)-8,8-dimethyl-1-aza-20-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2(7),3,5,9,11,13(21),14(19),15,17-nonaene |
|---|---|
| PubChem CID | 170519550 |
| Molecular Formula | C56H52BNO |
| Molecular Weight | 765.85 g/mol |
| Exact Mass | 765.41 |
| IUPAC Name | 5,11-ditert-butyl-20-dibenzofuran-2-yl-16-(9,9-dimethylfluoren-3-yl)-8,8-dimethyl-1-aza-20-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2(7),3,5,9,11,13(21),14(19),15,17-nonaene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C)cc3c1N2B(c1ccc2oc4ccccc4c2c1)c1ccc(-c2ccc4c(c2)-c2ccccc2C4(C)C)cc1-3 |
| InChI | InChI=1S/C56H52BNO/c1-53(2,3)35-21-25-49-46(30-35)56(9,10)47-31-36(54(4,5)6)29-43-41-28-34(33-19-23-45-40(27-33)38-15-11-13-17-44(38)55(45,7)8)20-24-48(41)57(58(49)52(43)47)37-22-26-51-42(32-37)39-16-12-14-18-50(39)59-51/h11-32H,1-10H3 |
| InChIKey | SOJFDWYPEJMCRO-UHFFFAOYSA-N |
| XLogP | 13.72 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.85 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|