C19H30N2 — CID 170522582
(7R,8R)-2,7,8,9-tetramethyl-4,5-di(propan-2-yl)-7,8-dihydropyrido[2,3-b]azepine (PubChem CID 170522582) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is (7R,8R)-2,7,8,9-tetramethyl-4,5-di(propan-2-yl)-7,8-dihydropyrido[2,3-b]azepine.
| Compound Name | (7R,8R)-2,7,8,9-tetramethyl-4,5-di(propan-2-yl)-7,8-dihydropyrido[2,3-b]azepine |
|---|---|
| PubChem CID | 170522582 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | (7R,8R)-2,7,8,9-tetramethyl-4,5-di(propan-2-yl)-7,8-dihydropyrido[2,3-b]azepine |
| SMILES | Cc1cc(C(C)C)c2c(n1)N(C)[C@H](C)[C@H](C)C=C2C(C)C |
| InChI | InChI=1S/C19H30N2/c1-11(2)16-9-13(5)15(7)21(8)19-18(16)17(12(3)4)10-14(6)20-19/h9-13,15H,1-8H3/t13-,15-/m1/s1 |
| InChIKey | LNAJWFKLNMYEHE-UKRRQHHQSA-N |
| XLogP | 5.03 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |