C21H35NS — CID 170522635
(5S,6R,7R)-3,4,5,6,7-pentamethyl-1,10-di(propan-2-yl)-6,7,9,10-tetrahydro-5H-thiocino[4,5-c]pyridine (PubChem CID 170522635) has the molecular formula C21H35NS and a molecular weight of 333.59 g/mol. Its IUPAC name is (5S,6R,7R)-3,4,5,6,7-pentamethyl-1,10-di(propan-2-yl)-6,7,9,10-tetrahydro-5H-thiocino[4,5-c]pyridine.
| Compound Name | (5S,6R,7R)-3,4,5,6,7-pentamethyl-1,10-di(propan-2-yl)-6,7,9,10-tetrahydro-5H-thiocino[4,5-c]pyridine |
|---|---|
| PubChem CID | 170522635 |
| Molecular Formula | C21H35NS |
| Molecular Weight | 333.59 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | (5S,6R,7R)-3,4,5,6,7-pentamethyl-1,10-di(propan-2-yl)-6,7,9,10-tetrahydro-5H-thiocino[4,5-c]pyridine |
| SMILES | Cc1nc(C(C)C)c2c(c1C)[C@@H](C)[C@@H](C)[C@@H](C)SCC2C(C)C |
| InChI | InChI=1S/C21H35NS/c1-11(2)18-10-23-17(9)13(5)14(6)19-15(7)16(8)22-21(12(3)4)20(18)19/h11-14,17-18H,10H2,1-9H3/t13-,14+,17-,18?/m1/s1 |
| InChIKey | KXSKSWGTBSNVEE-WBXBSLSUSA-N |
| XLogP | 6.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.59 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |