C19H31NS — CID 170522653
(2R,3R)-2,3,8,9-tetramethyl-5,6-di(propan-2-yl)-2,3,4,5-tetrahydrothiepino[3,2-c]pyridine (PubChem CID 170522653) has the molecular formula C19H31NS and a molecular weight of 305.53 g/mol. Its IUPAC name is (2R,3R)-2,3,8,9-tetramethyl-5,6-di(propan-2-yl)-2,3,4,5-tetrahydrothiepino[3,2-c]pyridine.
| Compound Name | (2R,3R)-2,3,8,9-tetramethyl-5,6-di(propan-2-yl)-2,3,4,5-tetrahydrothiepino[3,2-c]pyridine |
|---|---|
| PubChem CID | 170522653 |
| Molecular Formula | C19H31NS |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (2R,3R)-2,3,8,9-tetramethyl-5,6-di(propan-2-yl)-2,3,4,5-tetrahydrothiepino[3,2-c]pyridine |
| SMILES | Cc1nc(C(C)C)c2c(c1C)S[C@H](C)[C@H](C)CC2C(C)C |
| InChI | InChI=1S/C19H31NS/c1-10(2)16-9-12(5)15(8)21-19-13(6)14(7)20-18(11(3)4)17(16)19/h10-12,15-16H,9H2,1-8H3/t12-,15-,16?/m1/s1 |
| InChIKey | RIIDPNIZTVJGMX-CEPMMTIFSA-N |
| XLogP | 6.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |