C18H30N2 — CID 170522830
(3S,4R)-3,4,5,6-tetramethyl-1,8-di(propan-2-yl)-3,4-dihydro-2H-1,7-naphthyridine (PubChem CID 170522830) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is (3S,4R)-3,4,5,6-tetramethyl-1,8-di(propan-2-yl)-3,4-dihydro-2H-1,7-naphthyridine.
| Compound Name | (3S,4R)-3,4,5,6-tetramethyl-1,8-di(propan-2-yl)-3,4-dihydro-2H-1,7-naphthyridine |
|---|---|
| PubChem CID | 170522830 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | (3S,4R)-3,4,5,6-tetramethyl-1,8-di(propan-2-yl)-3,4-dihydro-2H-1,7-naphthyridine |
| SMILES | Cc1nc(C(C)C)c2c(c1C)[C@H](C)[C@H](C)CN2C(C)C |
| InChI | InChI=1S/C18H30N2/c1-10(2)17-18-16(14(7)15(8)19-17)13(6)12(5)9-20(18)11(3)4/h10-13H,9H2,1-8H3/t12-,13-/m1/s1 |
| InChIKey | UFOVUNLDGAJPBW-CHWSQXEVSA-N |
| XLogP | 4.79 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |