C21H17N5O — CID 17052339
1,5-diphenyl-N-(pyridin-3-ylmethyl)-1,2,4-triazole-3-carboxamide (PubChem CID 17052339) has the molecular formula C21H17N5O and a molecular weight of 355.40 g/mol. Its IUPAC name is 1,5-diphenyl-N-(pyridin-3-ylmethyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1,5-diphenyl-N-(pyridin-3-ylmethyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 17052339 |
| Molecular Formula | C21H17N5O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1,5-diphenyl-N-(pyridin-3-ylmethyl)-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H17N5O/c27-21(23-15-16-8-7-13-22-14-16)19-24-20(17-9-3-1-4-10-17)26(25-19)18-11-5-2-6-12-18/h1-14H,15H2,(H,23,27) |
| InChIKey | WPRFWADGJIYGNI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |