C39H29N7O6 — CID 170523887
butyl 3-[2-[3-[3-[3-[5-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,3-oxazol-4-yl]benzoate (PubChem CID 170523887) has the molecular formula C39H29N7O6 and a molecular weight of 691.70 g/mol. Its IUPAC name is butyl 3-[2-[3-[3-[3-[5-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,3-oxazol-4-yl]benzoate.
| Compound Name | butyl 3-[2-[3-[3-[3-[5-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,3-oxazol-4-yl]benzoate |
|---|---|
| PubChem CID | 170523887 |
| Molecular Formula | C39H29N7O6 |
| Molecular Weight | 691.70 g/mol |
| Exact Mass | 691.22 |
| IUPAC Name | butyl 3-[2-[3-[3-[3-[5-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,3-oxazol-4-yl]benzoate |
| SMILES | CCCCOC(=O)c1cccc(-c2coc(-c3cccc(-c4nc(-c5cccc(-c6noc(-c7cccc(-c8nc(C)no8)c7)n6)c5)no4)c3)n2)c1 |
| InChI | InChI=1S/C39H29N7O6/c1-3-4-17-48-39(47)31-16-5-9-24(18-31)32-22-49-35(41-32)27-12-7-14-29(20-27)37-42-33(45-51-37)25-10-6-11-26(19-25)34-43-38(52-46-34)30-15-8-13-28(21-30)36-40-23(2)44-50-36/h5-16,18-22H,3-4,17H2,1-2H3 |
| InChIKey | JPJMXWIRLFCUMT-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 169.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.70 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|