C28H21N3 — CID 170523971
N,6-diphenyl-N-(1-phenyl-2H-pyridin-1-ium-2-id-3-yl)pyridin-2-amine (PubChem CID 170523971) has the molecular formula C28H21N3 and a molecular weight of 399.50 g/mol. Its IUPAC name is N,6-diphenyl-N-(1-phenyl-2H-pyridin-1-ium-2-id-3-yl)pyridin-2-amine.
| Compound Name | N,6-diphenyl-N-(1-phenyl-2H-pyridin-1-ium-2-id-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 170523971 |
| Molecular Formula | C28H21N3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N,6-diphenyl-N-(1-phenyl-2H-pyridin-1-ium-2-id-3-yl)pyridin-2-amine |
| SMILES | [c-]1c(N(c2ccccc2)c2cccc(-c3ccccc3)n2)ccc[n+]1-c1ccccc1 |
| InChI | InChI=1S/C28H21N3/c1-4-12-23(13-5-1)27-19-10-20-28(29-27)31(25-16-8-3-9-17-25)26-18-11-21-30(22-26)24-14-6-2-7-15-24/h1-21H |
| InChIKey | UOISRABWDCXRSL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|