C17H22BBrO3 — CID 170524064
4-bromo-2-cyclopropyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenol (PubChem CID 170524064) has the molecular formula C17H22BBrO3 and a molecular weight of 365.08 g/mol. Its IUPAC name is 4-bromo-2-cyclopropyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenol.
| Compound Name | 4-bromo-2-cyclopropyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 170524064 |
| Molecular Formula | C17H22BBrO3 |
| Molecular Weight | 365.08 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 4-bromo-2-cyclopropyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenol |
| SMILES | CC1(C)OB(/C=C/c2cc(Br)cc(C3CC3)c2O)OC1(C)C |
| InChI | InChI=1S/C17H22BBrO3/c1-16(2)17(3,4)22-18(21-16)8-7-12-9-13(19)10-14(15(12)20)11-5-6-11/h7-11,20H,5-6H2,1-4H3/b8-7+ |
| InChIKey | PRVATJWNVXBCDX-BQYQJAHWSA-N |
| XLogP | 4.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.08 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|