C12H23NO3 — CID 170524626
tert-butyl (4S)-3-tert-butyl-1,3-oxazolidine-4-carboxylate (PubChem CID 170524626) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl (4S)-3-tert-butyl-1,3-oxazolidine-4-carboxylate.
| Compound Name | tert-butyl (4S)-3-tert-butyl-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 170524626 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | tert-butyl (4S)-3-tert-butyl-1,3-oxazolidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1COCN1C(C)(C)C |
| InChI | InChI=1S/C12H23NO3/c1-11(2,3)13-8-15-7-9(13)10(14)16-12(4,5)6/h9H,7-8H2,1-6H3/t9-/m0/s1 |
| InChIKey | MYQAZCZGPYTQDZ-VIFPVBQESA-N |
| XLogP | 1.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |