About cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol)
cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol) (PubChem CID 170524784) has the molecular formula C36H34CoN6O4
and a molecular weight of 673.64 g/mol. Its IUPAC name is cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol).
Molecular Properties
| Compound Name | cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol) |
| PubChem CID | 170524784 |
| Molecular Formula | C36H34CoN6O4 |
| Molecular Weight | 673.64 g/mol |
| Exact Mass | 673.20 |
| IUPAC Name | cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol) |
| SMILES | Cc1cccc(O)c1/N=C\c1c(C)nn(-c2ccccc2)c1O.Cc1cccc(O)c1/N=C\c1c(C)nn(-c2ccccc2)c1O.[Co] |
| InChI | InChI=1S/2C18H17N3O2.Co/c2*1-12-7-6-10-16(22)17(12)19-11-15-13(2)20-21(18(15)23)14-8-4-3-5-9-14;/h2*3-11,22-23H,1-2H3;/b2*19-11-; |
| InChIKey | YVTXUXJEUSJVRS-JPOFALDVSA-N |
| XLogP | 7.30 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 673.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_5_pyrazole_OH(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol)?
The IUPAC name of cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol) (CID 170524784) is cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol).
What is the SMILES notation for cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol)?
The canonical SMILES for cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol) is Cc1cccc(O)c1/N=C\c1c(C)nn(-c2ccccc2)c1O.Cc1cccc(O)c1/N=C\c1c(C)nn(-c2ccccc2)c1O.[Co].
What is the InChIKey of cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol)?
The InChIKey is YVTXUXJEUSJVRS-JPOFALDVSA-N. The full InChI is InChI=1S/2C18H17N3O2.Co/c2*1-12-7-6-10-16(22)17(12)19-11-15-13(2)20-21(18(15)23)14-8-4-3-5-9-14;/h2*3-11,22-23H,1-2H3;/b2*19-11-;.
What are the key properties of cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol)?
cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol) has a molecular weight of 673.64 g/mol, XLogP of 7.30, 6 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(4-[(2-hydroxy-6-methylphenyl)iminomethyl]-3-methyl-1-phenylpyrazol-5-ol) is sourced from PubChem (CID 170524784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).