C19H18BrN3O4 — CID 170524862
ethyl 4-[(5-bromo-2-hydroxyanilino)methyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate (PubChem CID 170524862) has the molecular formula C19H18BrN3O4 and a molecular weight of 432.27 g/mol. Its IUPAC name is ethyl 4-[(5-bromo-2-hydroxyanilino)methyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 4-[(5-bromo-2-hydroxyanilino)methyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 170524862 |
| Molecular Formula | C19H18BrN3O4 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | ethyl 4-[(5-bromo-2-hydroxyanilino)methyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]n(-c2ccccc2)c(=O)c1CNc1cc(Br)ccc1O |
| InChI | InChI=1S/C19H18BrN3O4/c1-2-27-19(26)17-14(11-21-15-10-12(20)8-9-16(15)24)18(25)23(22-17)13-6-4-3-5-7-13/h3-10,21-22,24H,2,11H2,1H3 |
| InChIKey | DRQLCODYCFNSTN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|