C23H25N3O4S — CID 170525045
5-cyclohexyl-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-2-phenyl-1H-pyrazol-3-one (PubChem CID 170525045) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 5-cyclohexyl-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 5-cyclohexyl-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 170525045 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 5-cyclohexyl-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-2-phenyl-1H-pyrazol-3-one |
| SMILES | CS(=O)(=O)c1ccc(O)c(/N=C/c2c(C3CCCCC3)[nH]n(-c3ccccc3)c2=O)c1 |
| InChI | InChI=1S/C23H25N3O4S/c1-31(29,30)18-12-13-21(27)20(14-18)24-15-19-22(16-8-4-2-5-9-16)25-26(23(19)28)17-10-6-3-7-11-17/h3,6-7,10-16,25,27H,2,4-5,8-9H2,1H3/b24-15+ |
| InChIKey | NRMOJTDOOLWQEW-BUVRLJJBSA-N |
| XLogP | 4.07 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|