C19H21Cl2N3O4 — CID 17052537
2,2-dichloro-N-[5-[(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)methyl]-2-methoxyphenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 17052537) has the molecular formula C19H21Cl2N3O4 and a molecular weight of 426.30 g/mol. Its IUPAC name is 2,2-dichloro-N-[5-[(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)methyl]-2-methoxyphenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[5-[(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)methyl]-2-methoxyphenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 17052537 |
| Molecular Formula | C19H21Cl2N3O4 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2,2-dichloro-N-[5-[(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)methyl]-2-methoxyphenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | COc1ccc(CN2C(=O)C3CCCN3C2=O)cc1NC(=O)C1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C19H21Cl2N3O4/c1-18(10-19(18,20)21)16(26)22-12-8-11(5-6-14(12)28-2)9-24-15(25)13-4-3-7-23(13)17(24)27/h5-6,8,13H,3-4,7,9-10H2,1-2H3,(H,22,26) |
| InChIKey | NZCAKJVOUJBDLP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|