C17H19BrN2O3S2 — CID 17052672
2-(4-bromo-3-methyl-N-methylsulfonylanilino)-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 17052672) has the molecular formula C17H19BrN2O3S2 and a molecular weight of 443.39 g/mol. Its IUPAC name is 2-(4-bromo-3-methyl-N-methylsulfonylanilino)-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-(4-bromo-3-methyl-N-methylsulfonylanilino)-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 17052672 |
| Molecular Formula | C17H19BrN2O3S2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | 2-(4-bromo-3-methyl-N-methylsulfonylanilino)-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccccc1NC(=O)CN(c1ccc(Br)c(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H19BrN2O3S2/c1-12-10-13(8-9-14(12)18)20(25(3,22)23)11-17(21)19-15-6-4-5-7-16(15)24-2/h4-10H,11H2,1-3H3,(H,19,21) |
| InChIKey | NVLJBLLDBVELPP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |