C13H9N5O5 — CID 17052747
3-(1,3-benzodioxol-5-yl)-5-(1-methyl-5-nitropyrazol-3-yl)-1,2,4-oxadiazole (PubChem CID 17052747) has the molecular formula C13H9N5O5 and a molecular weight of 315.25 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-(1-methyl-5-nitropyrazol-3-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-(1-methyl-5-nitropyrazol-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 17052747 |
| Molecular Formula | C13H9N5O5 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-(1-methyl-5-nitropyrazol-3-yl)-1,2,4-oxadiazole |
| SMILES | Cn1nc(-c2nc(-c3ccc4c(c3)OCO4)no2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9N5O5/c1-17-11(18(19)20)5-8(15-17)13-14-12(16-23-13)7-2-3-9-10(4-7)22-6-21-9/h2-5H,6H2,1H3 |
| InChIKey | UTUDRDFTEUEIKB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|