C34H43BrN4O3 — CID 170529536
3-[7-[(3S)-1-[4-[4-(3-bromo-2-methylphenoxy)cyclohexyl]butyl]pyrrolidin-3-yl]-1-methylindazol-3-yl]piperidine-2,6-dione (PubChem CID 170529536) has the molecular formula C34H43BrN4O3 and a molecular weight of 635.65 g/mol. Its IUPAC name is 3-[7-[(3S)-1-[4-[4-(3-bromo-2-methylphenoxy)cyclohexyl]butyl]pyrrolidin-3-yl]-1-methylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[(3S)-1-[4-[4-(3-bromo-2-methylphenoxy)cyclohexyl]butyl]pyrrolidin-3-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170529536 |
| Molecular Formula | C34H43BrN4O3 |
| Molecular Weight | 635.65 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | 3-[7-[(3S)-1-[4-[4-(3-bromo-2-methylphenoxy)cyclohexyl]butyl]pyrrolidin-3-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
| SMILES | Cc1c(Br)cccc1OC1CCC(CCCCN2CC[C@@H](c3cccc4c(C5CCC(=O)NC5=O)nn(C)c34)C2)CC1 |
| InChI | InChI=1S/C34H43BrN4O3/c1-22-29(35)10-6-11-30(22)42-25-14-12-23(13-15-25)7-3-4-19-39-20-18-24(21-39)26-8-5-9-27-32(37-38(2)33(26)27)28-16-17-31(40)36-34(28)41/h5-6,8-11,23-25,28H,3-4,7,12-21H2,1-2H3,(H,36,40,41)/t23?,24-,25?,28?/m1/s1 |
| InChIKey | OEPPSDPCUJTXNJ-HMPWWTIVSA-N |
| XLogP | 6.76 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|