C15H24NO4- — CID 170530090
1-(2-methylbutan-2-yloxycarbonyl)-1-azaspiro[4.4]nonane-2-carboxylate (PubChem CID 170530090) has the molecular formula C15H24NO4- and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-(2-methylbutan-2-yloxycarbonyl)-1-azaspiro[4.4]nonane-2-carboxylate.
| Compound Name | 1-(2-methylbutan-2-yloxycarbonyl)-1-azaspiro[4.4]nonane-2-carboxylate |
|---|---|
| PubChem CID | 170530090 |
| Molecular Formula | C15H24NO4- |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-(2-methylbutan-2-yloxycarbonyl)-1-azaspiro[4.4]nonane-2-carboxylate |
| SMILES | CCC(C)(C)OC(=O)N1C(C(=O)[O-])CCC12CCCC2 |
| InChI | InChI=1S/C15H25NO4/c1-4-14(2,3)20-13(19)16-11(12(17)18)7-10-15(16)8-5-6-9-15/h11H,4-10H2,1-3H3,(H,17,18)/p-1 |
| InChIKey | XQDQRLGGWFYENZ-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |