C11H4F6I3O5S- — CID 170530977
3,3,3-trifluoro-2-(trifluoromethyl)-2-(2,3,4-triiodobenzoyl)oxypropane-1-sulfonate (PubChem CID 170530977) has the molecular formula C11H4F6I3O5S- and a molecular weight of 742.91 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(trifluoromethyl)-2-(2,3,4-triiodobenzoyl)oxypropane-1-sulfonate.
| Compound Name | 3,3,3-trifluoro-2-(trifluoromethyl)-2-(2,3,4-triiodobenzoyl)oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 170530977 |
| Molecular Formula | C11H4F6I3O5S- |
| Molecular Weight | 742.91 g/mol |
| Exact Mass | 742.68 |
| IUPAC Name | 3,3,3-trifluoro-2-(trifluoromethyl)-2-(2,3,4-triiodobenzoyl)oxypropane-1-sulfonate |
| SMILES | O=C(OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F)c1ccc(I)c(I)c1I |
| InChI | InChI=1S/C11H5F6I3O5S/c12-10(13,14)9(11(15,16)17,3-26(22,23)24)25-8(21)4-1-2-5(18)7(20)6(4)19/h1-2H,3H2,(H,22,23,24)/p-1 |
| InChIKey | LTRZUCKHOYKMFR-UHFFFAOYSA-M |
| XLogP | 4.07 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.91 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|