C21H19NO9S — CID 170532154
2,3-dimethyl-4-[4-(5-methyl-1,3-dioxoisoindol-2-yl)oxysulfonylphenoxy]-4-oxobutanoic acid (PubChem CID 170532154) has the molecular formula C21H19NO9S and a molecular weight of 461.45 g/mol. Its IUPAC name is 2,3-dimethyl-4-[4-(5-methyl-1,3-dioxoisoindol-2-yl)oxysulfonylphenoxy]-4-oxobutanoic acid.
| Compound Name | 2,3-dimethyl-4-[4-(5-methyl-1,3-dioxoisoindol-2-yl)oxysulfonylphenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 170532154 |
| Molecular Formula | C21H19NO9S |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2,3-dimethyl-4-[4-(5-methyl-1,3-dioxoisoindol-2-yl)oxysulfonylphenoxy]-4-oxobutanoic acid |
| SMILES | Cc1ccc2c(c1)C(=O)N(OS(=O)(=O)c1ccc(OC(=O)C(C)C(C)C(=O)O)cc1)C2=O |
| InChI | InChI=1S/C21H19NO9S/c1-11-4-9-16-17(10-11)19(24)22(18(16)23)31-32(28,29)15-7-5-14(6-8-15)30-21(27)13(3)12(2)20(25)26/h4-10,12-13H,1-3H3,(H,25,26) |
| InChIKey | KIXLWMYCCDCQMA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|