C26H19NO5S — CID 170532158
(1,3-dioxobenzo[de]isoquinolin-2-yl) 1,2-dimethyl-1,2-dihydroacenaphthylene-5-sulfonate (PubChem CID 170532158) has the molecular formula C26H19NO5S and a molecular weight of 457.51 g/mol. Its IUPAC name is (1,3-dioxobenzo[de]isoquinolin-2-yl) 1,2-dimethyl-1,2-dihydroacenaphthylene-5-sulfonate.
| Compound Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) 1,2-dimethyl-1,2-dihydroacenaphthylene-5-sulfonate |
|---|---|
| PubChem CID | 170532158 |
| Molecular Formula | C26H19NO5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) 1,2-dimethyl-1,2-dihydroacenaphthylene-5-sulfonate |
| SMILES | CC1c2cccc3c(S(=O)(=O)ON4C(=O)c5cccc6cccc(c56)C4=O)ccc(c23)C1C |
| InChI | InChI=1S/C26H19NO5S/c1-14-15(2)18-12-13-22(19-9-5-8-17(14)24(18)19)33(30,31)32-27-25(28)20-10-3-6-16-7-4-11-21(23(16)20)26(27)29/h3-15H,1-2H3 |
| InChIKey | IKDBUCVFOZFWSP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|