About [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate
[4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate (PubChem CID 170532230) has the molecular formula C21H18F3NO7S
and a molecular weight of 485.44 g/mol. Its IUPAC name is [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate |
| PubChem CID | 170532230 |
| Molecular Formula | C21H18F3NO7S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(S(=O)(=O)ON2C(=O)c3ccc(C(F)(F)F)cc3C2=O)cc1 |
| InChI | InChI=1S/C21H18F3NO7S/c1-4-20(2,3)19(28)31-13-6-8-14(9-7-13)33(29,30)32-25-17(26)15-10-5-12(21(22,23)24)11-16(15)18(25)27/h5-11H,4H2,1-3H3 |
| InChIKey | WHWZRNNTEOQIQM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate?
The IUPAC name of [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate (CID 170532230) is [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate.
What is the SMILES notation for [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate?
The canonical SMILES for [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)Oc1ccc(S(=O)(=O)ON2C(=O)c3ccc(C(F)(F)F)cc3C2=O)cc1.
What is the InChIKey of [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate?
The InChIKey is WHWZRNNTEOQIQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F3NO7S/c1-4-20(2,3)19(28)31-13-6-8-14(9-7-13)33(29,30)32-25-17(26)15-10-5-12(21(22,23)24)11-16(15)18(25)27/h5-11H,4H2,1-3H3.
What are the key properties of [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate?
[4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate has a molecular weight of 485.44 g/mol, XLogP of 3.96, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1,3-dioxo-5-(trifluoromethyl)isoindol-2-yl]oxysulfonylphenyl] 2,2-dimethylbutanoate is sourced from PubChem (CID 170532230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).