C16H30N5O+3 — CID 170533516
trimethyl-[1,9,9-trimethyl-1-(2-methylbutyl)-6-oxopurine-1,9-diium-2-yl]azanium (PubChem CID 170533516) has the molecular formula C16H30N5O+3 and a molecular weight of 308.45 g/mol. Its IUPAC name is trimethyl-[1,9,9-trimethyl-1-(2-methylbutyl)-6-oxopurine-1,9-diium-2-yl]azanium.
| Compound Name | trimethyl-[1,9,9-trimethyl-1-(2-methylbutyl)-6-oxopurine-1,9-diium-2-yl]azanium |
|---|---|
| PubChem CID | 170533516 |
| Molecular Formula | C16H30N5O+3 |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | trimethyl-[1,9,9-trimethyl-1-(2-methylbutyl)-6-oxopurine-1,9-diium-2-yl]azanium |
| SMILES | CCC(C)C[N+]1(C)C(=O)C2=C(N=C1[N+](C)(C)C)[N+](C)(C)C=N2 |
| InChI | InChI=1S/C16H30N5O/c1-9-12(2)10-21(8)15(22)13-14(20(6,7)11-17-13)18-16(21)19(3,4)5/h11-12H,9-10H2,1-8H3/q+3 |
| InChIKey | GDQXOXPCBGQMBQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|