C9H13ClN2O2 — CID 170533596
1-chloro-3-(2-methylbutyl)pyrimidine-2,4-dione (PubChem CID 170533596) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 1-chloro-3-(2-methylbutyl)pyrimidine-2,4-dione.
| Compound Name | 1-chloro-3-(2-methylbutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170533596 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1-chloro-3-(2-methylbutyl)pyrimidine-2,4-dione |
| SMILES | CCC(C)Cn1c(=O)ccn(Cl)c1=O |
| InChI | InChI=1S/C9H13ClN2O2/c1-3-7(2)6-11-8(13)4-5-12(10)9(11)14/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | NYPRTESVFKEFII-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |