C30H35F2N9 — CID 170533779
2-[4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-5-ethyl-2-methylpiperazin-1-yl]-2-deuterio-[1,2,4]triazolo[3,4-b]purin-1-yl]-N,N-dimethylethanamine (PubChem CID 170533779) has the molecular formula C30H35F2N9 and a molecular weight of 560.68 g/mol. Its IUPAC name is 2-[4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-5-ethyl-2-methylpiperazin-1-yl]-2-deuterio-[1,2,4]triazolo[3,4-b]purin-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-5-ethyl-2-methylpiperazin-1-yl]-2-deuterio-[1,2,4]triazolo[3,4-b]purin-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 170533779 |
| Molecular Formula | C30H35F2N9 |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 2-[4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-5-ethyl-2-methylpiperazin-1-yl]-2-deuterio-[1,2,4]triazolo[3,4-b]purin-1-yl]-N,N-dimethylethanamine |
| SMILES | [2H]c1nc2c(N3C[C@@H](CC)N(C(c4ccc(F)cc4)c4ccc(F)cc4)C[C@@H]3C)nc3nncn3c2n1CCN(C)C |
| InChI | InChI=1S/C30H35F2N9/c1-5-25-17-39(28-26-29(41-19-34-36-30(41)35-28)38(18-33-26)15-14-37(3)4)20(2)16-40(25)27(21-6-10-23(31)11-7-21)22-8-12-24(32)13-9-22/h6-13,18-20,25,27H,5,14-17H2,1-4H3/t20-,25+/m0/s1/i18D |
| InChIKey | VLKOICBKVZZSMH-SJLXXRGZSA-N |
| XLogP | 4.39 |
| TPSA | 70.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |