C16H16O3 — CID 170534157
2-(7-hydroxyhepta-2,5-diynyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 170534157) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-(7-hydroxyhepta-2,5-diynyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(7-hydroxyhepta-2,5-diynyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 170534157 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-(7-hydroxyhepta-2,5-diynyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CC#CCC#CCO)=C(C)C1=O |
| InChI | InChI=1S/C16H16O3/c1-11-12(2)16(19)14(13(3)15(11)18)9-7-5-4-6-8-10-17/h17H,4,9-10H2,1-3H3 |
| InChIKey | YQJRBLMVVLAFFS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|