About tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate
tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate (PubChem CID 170534276) has the molecular formula C14H18O5
and a molecular weight of 266.29 g/mol. Its IUPAC name is tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate.
Analyze tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate?
The IUPAC name of tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate (CID 170534276) is tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate.
What is the SMILES notation for tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate?
The canonical SMILES for tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate is CCOc1cccc(=O)c(OC(=O)OC(C)(C)C)c1.
What is the InChIKey of tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate?
The InChIKey is NRJYTVPSBZKEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5/c1-5-17-10-7-6-8-11(15)12(9-10)18-13(16)19-14(2,3)4/h6-9H,5H2,1-4H3.
What are the key properties of tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate?
tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate has a molecular weight of 266.29 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3-ethoxy-7-oxocyclohepta-1,3,5-trien-1-yl) carbonate is sourced from PubChem (CID 170534276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).