C52H33NOS — CID 170535406
N-(4-dibenzothiophen-2-ylphenyl)-3-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-N-(4-naphthalen-1-ylphenyl)aniline (PubChem CID 170535406) has the molecular formula C52H33NOS and a molecular weight of 726.95 g/mol. Its IUPAC name is N-(4-dibenzothiophen-2-ylphenyl)-3-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-N-(4-naphthalen-1-ylphenyl)aniline.
| Compound Name | N-(4-dibenzothiophen-2-ylphenyl)-3-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-N-(4-naphthalen-1-ylphenyl)aniline |
|---|---|
| PubChem CID | 170535406 |
| Molecular Formula | C52H33NOS |
| Molecular Weight | 726.95 g/mol |
| Exact Mass | 726.27 |
| IUPAC Name | N-(4-dibenzothiophen-2-ylphenyl)-3-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-N-(4-naphthalen-1-ylphenyl)aniline |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c(-c4cccc(N(c5ccc(-c6ccc7sc8ccccc8c7c6)cc5)c5ccc(-c6cccc7ccccc67)cc5)c4)c([2H])c32)c1[2H] |
| InChI | InChI=1S/C52H33NOS/c1-2-13-43-35(9-1)10-8-16-44(43)36-21-27-41(28-22-36)53(40-25-19-34(20-26-40)38-24-30-52-48(33-38)46-15-4-6-18-51(46)55-52)42-12-7-11-37(31-42)39-23-29-50-47(32-39)45-14-3-5-17-49(45)54-50/h1-33H/i3D,5D,14D,17D,23D,29D,32D |
| InChIKey | ZEHJNBBAZXBJIA-KXIFSFIUSA-N |
| XLogP | 15.58 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.95 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |