C33H24N4 — CID 170536719
N-[(methylideneamino)-phenylmethylidene]-3-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)-5-phenylbenzenecarboximidamide (PubChem CID 170536719) has the molecular formula C33H24N4 and a molecular weight of 484.63 g/mol. Its IUPAC name is N-[(methylideneamino)-phenylmethylidene]-3-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)-5-phenylbenzenecarboximidamide.
| Compound Name | N-[(methylideneamino)-phenylmethylidene]-3-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)-5-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 170536719 |
| Molecular Formula | C33H24N4 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | N-[(methylideneamino)-phenylmethylidene]-3-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)-5-phenylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N=C(/N=C)c1ccccc1)c1cc(-c2ccccc2)cc(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c([2H])c([2H])c([2H])c([2H])c32)c1 |
| InChI | InChI=1S/C33H24N4/c1-35-33(24-14-6-3-7-15-24)36-32(34)26-20-25(23-12-4-2-5-13-23)21-27(22-26)37-30-18-10-8-16-28(30)29-17-9-11-19-31(29)37/h2-22,34H,1H2/b34-32-,36-33-/i8D,9D,10D,11D,16D,17D,18D,19D |
| InChIKey | RAVSRINATLFVMG-JDURGICDSA-N |
| XLogP | 7.92 |
| TPSA | 53.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|