About 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine
3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine (PubChem CID 170537548) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine |
| PubChem CID | 170537548 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine |
| SMILES | Nc1cccc(CNc2ccon2)c1N |
| InChI | InChI=1S/C10H12N4O/c11-8-3-1-2-7(10(8)12)6-13-9-4-5-15-14-9/h1-5H,6,11-12H2,(H,13,14) |
| InChIKey | IWUVIMOLURAFKM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine?
The IUPAC name of 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine (CID 170537548) is 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine.
What is the SMILES notation for 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine?
The canonical SMILES for 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine is Nc1cccc(CNc2ccon2)c1N.
What is the InChIKey of 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine?
The InChIKey is IWUVIMOLURAFKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c11-8-3-1-2-7(10(8)12)6-13-9-4-5-15-14-9/h1-5H,6,11-12H2,(H,13,14).
What are the key properties of 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine?
3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine has a molecular weight of 204.23 g/mol, XLogP of 1.45, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,2-oxazol-3-ylamino)methyl]benzene-1,2-diamine is sourced from PubChem (CID 170537548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).