C24H31N3O4Si — CID 170539996
N'-[4-[ethyl(dimethyl)silyl]phenyl]-1-[1-(4-methoxyphenyl)-2-oxoethyl]-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 170539996) has the molecular formula C24H31N3O4Si and a molecular weight of 453.62 g/mol. Its IUPAC name is N'-[4-[ethyl(dimethyl)silyl]phenyl]-1-[1-(4-methoxyphenyl)-2-oxoethyl]-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | N'-[4-[ethyl(dimethyl)silyl]phenyl]-1-[1-(4-methoxyphenyl)-2-oxoethyl]-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 170539996 |
| Molecular Formula | C24H31N3O4Si |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N'-[4-[ethyl(dimethyl)silyl]phenyl]-1-[1-(4-methoxyphenyl)-2-oxoethyl]-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | CC[Si](C)(C)c1ccc(NNC(=O)C2CC(=O)N(C(C=O)c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C24H31N3O4Si/c1-5-32(3,4)21-12-8-19(9-13-21)25-26-24(30)18-14-23(29)27(15-18)22(16-28)17-6-10-20(31-2)11-7-17/h6-13,16,18,22,25H,5,14-15H2,1-4H3,(H,26,30) |
| InChIKey | HBYJDEIRUOSJMO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|