C24H26BF3N4O4 — CID 170540603
[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[3-[[3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]azetidin-1-yl]methanone (PubChem CID 170540603) has the molecular formula C24H26BF3N4O4 and a molecular weight of 502.30 g/mol. Its IUPAC name is [(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[3-[[3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]azetidin-1-yl]methanone.
| Compound Name | [(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[3-[[3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 170540603 |
| Molecular Formula | C24H26BF3N4O4 |
| Molecular Weight | 502.30 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | [(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-[3-[[3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
| SMILES | CC1(C)OB(c2ccc(F)c(OC3CN(C(=O)N4N=CC[C@H]4c4cc(F)cc(F)c4)C3)n2)OC1(C)C |
| InChI | InChI=1S/C24H26BF3N4O4/c1-23(2)24(3,4)36-25(35-23)20-6-5-18(28)21(30-20)34-17-12-31(13-17)22(33)32-19(7-8-29-32)14-9-15(26)11-16(27)10-14/h5-6,8-11,17,19H,7,12-13H2,1-4H3/t19-/m0/s1 |
| InChIKey | FBGMDBZFNDOMKA-IBGZPJMESA-N |
| XLogP | 3.41 |
| TPSA | 76.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|