About benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate
benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate (PubChem CID 170540649) has the molecular formula C29H28F2N2O3
and a molecular weight of 490.55 g/mol. Its IUPAC name is benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate.
Molecular Properties
| Compound Name | benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate |
| PubChem CID | 170540649 |
| Molecular Formula | C29H28F2N2O3 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC2(CC1)CN(C(=O)Cc1ccc(C(F)F)cc1)c1ccccc12 |
| InChI | InChI=1S/C29H28F2N2O3/c30-27(31)23-12-10-21(11-13-23)18-26(34)33-20-29(24-8-4-5-9-25(24)33)14-16-32(17-15-29)28(35)36-19-22-6-2-1-3-7-22/h1-13,27H,14-20H2 |
| InChIKey | NOJLVYAXSUMOQN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate?
The IUPAC name of benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate (CID 170540649) is benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate.
What is the SMILES notation for benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate?
The canonical SMILES for benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate is O=C(OCc1ccccc1)N1CCC2(CC1)CN(C(=O)Cc1ccc(C(F)F)cc1)c1ccccc12.
What is the InChIKey of benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate?
The InChIKey is NOJLVYAXSUMOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H28F2N2O3/c30-27(31)23-12-10-21(11-13-23)18-26(34)33-20-29(24-8-4-5-9-25(24)33)14-16-32(17-15-29)28(35)36-19-22-6-2-1-3-7-22/h1-13,27H,14-20H2.
What are the key properties of benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate?
benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate has a molecular weight of 490.55 g/mol, XLogP of 5.88, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 1-[2-[4-(difluoromethyl)phenyl]acetyl]spiro[2H-indole-3,4'-piperidine]-1'-carboxylate is sourced from PubChem (CID 170540649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).