C24H14F4N6S — CID 170541420
2-[5,6,7,8-tetrafluoro-14,20-di(propan-2-yl)-17-thia-2,12,16,18-tetrazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),2,4(9),5,7,11,13,15,18-nonaen-10-ylidene]propanedinitrile (PubChem CID 170541420) has the molecular formula C24H14F4N6S and a molecular weight of 494.48 g/mol. Its IUPAC name is 2-[5,6,7,8-tetrafluoro-14,20-di(propan-2-yl)-17-thia-2,12,16,18-tetrazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),2,4(9),5,7,11,13,15,18-nonaen-10-ylidene]propanedinitrile.
| Compound Name | 2-[5,6,7,8-tetrafluoro-14,20-di(propan-2-yl)-17-thia-2,12,16,18-tetrazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),2,4(9),5,7,11,13,15,18-nonaen-10-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 170541420 |
| Molecular Formula | C24H14F4N6S |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 2-[5,6,7,8-tetrafluoro-14,20-di(propan-2-yl)-17-thia-2,12,16,18-tetrazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),2,4(9),5,7,11,13,15,18-nonaen-10-ylidene]propanedinitrile |
| SMILES | CC(C)c1c2nsnc2c(C(C)C)c2nc3c(nc12)C(=C(C#N)C#N)c1c(F)c(F)c(F)c(F)c1-3 |
| InChI | InChI=1S/C24H14F4N6S/c1-7(2)10-19-20(11(8(3)4)24-23(10)33-35-34-24)32-22-14-13(15(25)17(27)18(28)16(14)26)12(21(22)31-19)9(5-29)6-30/h7-8H,1-4H3 |
| InChIKey | BPJFGZVEARIXJX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 99.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|