C40H32N6 — CID 170541444
2-[17,18-bis(4-methylphenyl)-14,21-di(propan-2-yl)-2,12,16,19-tetrazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,14,16,18,20-decaen-10-ylidene]propanedinitrile (PubChem CID 170541444) has the molecular formula C40H32N6 and a molecular weight of 596.74 g/mol. Its IUPAC name is 2-[17,18-bis(4-methylphenyl)-14,21-di(propan-2-yl)-2,12,16,19-tetrazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,14,16,18,20-decaen-10-ylidene]propanedinitrile.
| Compound Name | 2-[17,18-bis(4-methylphenyl)-14,21-di(propan-2-yl)-2,12,16,19-tetrazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,14,16,18,20-decaen-10-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 170541444 |
| Molecular Formula | C40H32N6 |
| Molecular Weight | 596.74 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | 2-[17,18-bis(4-methylphenyl)-14,21-di(propan-2-yl)-2,12,16,19-tetrazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,14,16,18,20-decaen-10-ylidene]propanedinitrile |
| SMILES | Cc1ccc(-c2nc3c(C(C)C)c4nc5c(nc4c(C(C)C)c3nc2-c2ccc(C)cc2)-c2ccccc2C5=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C40H32N6/c1-21(2)30-36-37(44-34(26-17-13-24(6)14-18-26)33(43-36)25-15-11-23(5)12-16-25)31(22(3)4)39-38(30)45-35-29-10-8-7-9-28(29)32(40(35)46-39)27(19-41)20-42/h7-18,21-22H,1-6H3 |
| InChIKey | VZZBHGADBFAELF-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 99.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.74 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|