C30H42FN5O2S — CID 170541769
N-cyclohexyl-N'-[(2-fluoro-3-pyridinyl)methyl]-N-methyl-N'-[(1-pyrrolidin-1-ylsulfonylindol-3-yl)methyl]butane-1,4-diamine (PubChem CID 170541769) has the molecular formula C30H42FN5O2S and a molecular weight of 555.76 g/mol. Its IUPAC name is N-cyclohexyl-N'-[(2-fluoro-3-pyridinyl)methyl]-N-methyl-N'-[(1-pyrrolidin-1-ylsulfonylindol-3-yl)methyl]butane-1,4-diamine.
| Compound Name | N-cyclohexyl-N'-[(2-fluoro-3-pyridinyl)methyl]-N-methyl-N'-[(1-pyrrolidin-1-ylsulfonylindol-3-yl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 170541769 |
| Molecular Formula | C30H42FN5O2S |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | N-cyclohexyl-N'-[(2-fluoro-3-pyridinyl)methyl]-N-methyl-N'-[(1-pyrrolidin-1-ylsulfonylindol-3-yl)methyl]butane-1,4-diamine |
| SMILES | CN(CCCCN(Cc1cccnc1F)Cc1cn(S(=O)(=O)N2CCCC2)c2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C30H42FN5O2S/c1-33(27-13-3-2-4-14-27)18-7-8-19-34(22-25-12-11-17-32-30(25)31)23-26-24-36(29-16-6-5-15-28(26)29)39(37,38)35-20-9-10-21-35/h5-6,11-12,15-17,24,27H,2-4,7-10,13-14,18-23H2,1H3 |
| InChIKey | PDOLSZVSVNEGBF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|