C19H26ClNO — CID 17054224
2-methyl-N-[[2-[(4-methylphenyl)methoxy]phenyl]methyl]propan-2-amine;hydrochloride (PubChem CID 17054224) has the molecular formula C19H26ClNO and a molecular weight of 319.88 g/mol. Its IUPAC name is 2-methyl-N-[[2-[(4-methylphenyl)methoxy]phenyl]methyl]propan-2-amine;hydrochloride.
| Compound Name | 2-methyl-N-[[2-[(4-methylphenyl)methoxy]phenyl]methyl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17054224 |
| Molecular Formula | C19H26ClNO |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 2-methyl-N-[[2-[(4-methylphenyl)methoxy]phenyl]methyl]propan-2-amine;hydrochloride |
| SMILES | Cc1ccc(COc2ccccc2CNC(C)(C)C)cc1.Cl |
| InChI | InChI=1S/C19H25NO.ClH/c1-15-9-11-16(12-10-15)14-21-18-8-6-5-7-17(18)13-20-19(2,3)4;/h5-12,20H,13-14H2,1-4H3;1H |
| InChIKey | CVJVRRHMRJOMAH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |