C34H32F3NS3 — CID 170543760
7-(1,2-dimethyl-8-propan-2-ylthieno[2,3-b][1]benzothiol-6-yl)-3-methyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine (PubChem CID 170543760) has the molecular formula C34H32F3NS3 and a molecular weight of 607.83 g/mol. Its IUPAC name is 7-(1,2-dimethyl-8-propan-2-ylthieno[2,3-b][1]benzothiol-6-yl)-3-methyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine.
| Compound Name | 7-(1,2-dimethyl-8-propan-2-ylthieno[2,3-b][1]benzothiol-6-yl)-3-methyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 170543760 |
| Molecular Formula | C34H32F3NS3 |
| Molecular Weight | 607.83 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | 7-(1,2-dimethyl-8-propan-2-ylthieno[2,3-b][1]benzothiol-6-yl)-3-methyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine |
| SMILES | Cc1sc2sc3cc(-c4nccc5c(C)c(-c6ccc(CC(C)(C)C(F)(F)F)cc6)sc45)cc(C(C)C)c3c2c1C |
| InChI | InChI=1S/C34H32F3NS3/c1-17(2)25-14-23(15-26-28(25)27-18(3)20(5)39-32(27)40-26)29-31-24(12-13-38-29)19(4)30(41-31)22-10-8-21(9-11-22)16-33(6,7)34(35,36)37/h8-15,17H,16H2,1-7H3 |
| InChIKey | ZHIFICVUNCLSQS-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.83 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |