C34H38N10O4 — CID 170544027
3-[5-[7-[[4-(2-amino-7H-purin-6-yl)-2-methoxy-6-(methylamino)phenyl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170544027) has the molecular formula C34H38N10O4 and a molecular weight of 650.74 g/mol. Its IUPAC name is 3-[5-[7-[[4-(2-amino-7H-purin-6-yl)-2-methoxy-6-(methylamino)phenyl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[7-[[4-(2-amino-7H-purin-6-yl)-2-methoxy-6-(methylamino)phenyl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170544027 |
| Molecular Formula | C34H38N10O4 |
| Molecular Weight | 650.74 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | 3-[5-[7-[[4-(2-amino-7H-purin-6-yl)-2-methoxy-6-(methylamino)phenyl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CNc1cc(-c2nc(N)nc3nc[nH]c23)cc(OC)c1CN1CCC2(CC1)CN(c1ccc3c(c1)C(=O)N(C1CCC(=O)NC1=O)C3)C2 |
| InChI | InChI=1S/C34H38N10O4/c1-36-24-11-20(28-29-30(38-18-37-29)41-33(35)40-28)12-26(48-2)23(24)15-42-9-7-34(8-10-42)16-43(17-34)21-4-3-19-14-44(32(47)22(19)13-21)25-5-6-27(45)39-31(25)46/h3-4,11-13,18,25,36H,5-10,14-17H2,1-2H3,(H,39,45,46)(H3,35,37,38,40,41) |
| InChIKey | CSBLLOFQQMIKSD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 174.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|