C22H23ClFNO — CID 17054404
N-[(4-fluorophenyl)methyl]-1-[4-[(4-methylphenyl)methoxy]phenyl]methanamine;hydrochloride (PubChem CID 17054404) has the molecular formula C22H23ClFNO and a molecular weight of 371.88 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1-[4-[(4-methylphenyl)methoxy]phenyl]methanamine;hydrochloride.
| Compound Name | N-[(4-fluorophenyl)methyl]-1-[4-[(4-methylphenyl)methoxy]phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 17054404 |
| Molecular Formula | C22H23ClFNO |
| Molecular Weight | 371.88 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1-[4-[(4-methylphenyl)methoxy]phenyl]methanamine;hydrochloride |
| SMILES | Cc1ccc(COc2ccc(CNCc3ccc(F)cc3)cc2)cc1.Cl |
| InChI | InChI=1S/C22H22FNO.ClH/c1-17-2-4-20(5-3-17)16-25-22-12-8-19(9-13-22)15-24-14-18-6-10-21(23)11-7-18;/h2-13,24H,14-16H2,1H3;1H |
| InChIKey | GACXZSOASAXMBK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.88 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |