C27H24N4O4S — CID 170544566
N-[[2-(3-cyclopropylphenyl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxamide (PubChem CID 170544566) has the molecular formula C27H24N4O4S and a molecular weight of 500.58 g/mol. Its IUPAC name is N-[[2-(3-cyclopropylphenyl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxamide.
| Compound Name | N-[[2-(3-cyclopropylphenyl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 170544566 |
| Molecular Formula | C27H24N4O4S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | N-[[2-(3-cyclopropylphenyl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxamide |
| SMILES | O=C(NCc1cc2nc(-c3cccc(C4CC4)c3)ccc2cn1)c1cnc2c(c1)S(=O)(=O)CCOC2 |
| InChI | InChI=1S/C27H24N4O4S/c32-27(21-11-26-25(29-14-21)16-35-8-9-36(26,33)34)30-15-22-12-24-20(13-28-22)6-7-23(31-24)19-3-1-2-18(10-19)17-4-5-17/h1-3,6-7,10-14,17H,4-5,8-9,15-16H2,(H,30,32) |
| InChIKey | GXJQQSQXJONTCM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |