C26H25F2N5O4S — CID 170544723
4-(difluoromethyl)-N-[[2-[6-(2-methoxyethylamino)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-3-methylsulfonylbenzamide (PubChem CID 170544723) has the molecular formula C26H25F2N5O4S and a molecular weight of 541.58 g/mol. Its IUPAC name is 4-(difluoromethyl)-N-[[2-[6-(2-methoxyethylamino)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-3-methylsulfonylbenzamide.
| Compound Name | 4-(difluoromethyl)-N-[[2-[6-(2-methoxyethylamino)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 170544723 |
| Molecular Formula | C26H25F2N5O4S |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 4-(difluoromethyl)-N-[[2-[6-(2-methoxyethylamino)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-3-methylsulfonylbenzamide |
| SMILES | COCCNc1cccc(-c2ccc3cnc(CNC(=O)c4ccc(C(F)F)c(S(C)(=O)=O)c4)cc3n2)n1 |
| InChI | InChI=1S/C26H25F2N5O4S/c1-37-11-10-29-24-5-3-4-20(33-24)21-9-7-17-14-30-18(13-22(17)32-21)15-31-26(34)16-6-8-19(25(27)28)23(12-16)38(2,35)36/h3-9,12-14,25H,10-11,15H2,1-2H3,(H,29,33)(H,31,34) |
| InChIKey | QPLFXWPWHLCRBC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|