C48H48BNO2 — CID 170546619
1-(1-adamantyl)-9-(4,18-ditert-butyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)carbazole (PubChem CID 170546619) has the molecular formula C48H48BNO2 and a molecular weight of 681.73 g/mol. Its IUPAC name is 1-(1-adamantyl)-9-(4,18-ditert-butyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)carbazole.
| Compound Name | 1-(1-adamantyl)-9-(4,18-ditert-butyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)carbazole |
|---|---|
| PubChem CID | 170546619 |
| Molecular Formula | C48H48BNO2 |
| Molecular Weight | 681.73 g/mol |
| Exact Mass | 681.38 |
| IUPAC Name | 1-(1-adamantyl)-9-(4,18-ditert-butyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)B1c3cc(C(C)(C)C)ccc3Oc3cc(-n4c5ccccc5c5cccc(C67CC8CC(CC(C8)C6)C7)c54)cc(c31)O2 |
| InChI | InChI=1S/C48H48BNO2/c1-46(2,3)31-14-16-40-37(21-31)49-38-22-32(47(4,5)6)15-17-41(38)52-43-24-33(23-42(51-40)44(43)49)50-39-13-8-7-10-34(39)35-11-9-12-36(45(35)50)48-25-28-18-29(26-48)20-30(19-28)27-48/h7-17,21-24,28-30H,18-20,25-27H2,1-6H3 |
| InChIKey | ORGRYYSGPGXFFO-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.73 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|