C18H19BClF3N2O2 — CID 170546791
N-(2-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 170546791) has the molecular formula C18H19BClF3N2O2 and a molecular weight of 398.62 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(2-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 170546791 |
| Molecular Formula | C18H19BClF3N2O2 |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-(2-chlorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2ccc(C(F)(F)F)nc2Nc2ccccc2Cl)OC1(C)C |
| InChI | InChI=1S/C18H19BClF3N2O2/c1-16(2)17(3,4)27-19(26-16)11-9-10-14(18(21,22)23)25-15(11)24-13-8-6-5-7-12(13)20/h5-10H,1-4H3,(H,24,25) |
| InChIKey | YYDPNIOMESPYNJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|