About difluoroboranyl 2-oxoacetate
difluoroboranyl 2-oxoacetate (PubChem CID 170546863) has the molecular formula C2HBF2O3
and a molecular weight of 121.83 g/mol. Its IUPAC name is difluoroboranyl 2-oxoacetate.
Molecular Properties
| Compound Name | difluoroboranyl 2-oxoacetate |
| PubChem CID | 170546863 |
| Molecular Formula | C2HBF2O3 |
| Molecular Weight | 121.83 g/mol |
| Exact Mass | 122.00 |
| IUPAC Name | difluoroboranyl 2-oxoacetate |
| SMILES | O=CC(=O)OB(F)F |
| InChI | InChI=1S/C2HBF2O3/c4-3(5)8-2(7)1-6/h1H |
| InChIKey | CXLIMGBSQILIOR-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.83 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze difluoroboranyl 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoroboranyl 2-oxoacetate?
The IUPAC name of difluoroboranyl 2-oxoacetate (CID 170546863) is difluoroboranyl 2-oxoacetate.
What is the SMILES notation for difluoroboranyl 2-oxoacetate?
The canonical SMILES for difluoroboranyl 2-oxoacetate is O=CC(=O)OB(F)F.
What is the InChIKey of difluoroboranyl 2-oxoacetate?
The InChIKey is CXLIMGBSQILIOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HBF2O3/c4-3(5)8-2(7)1-6/h1H.
What are the key properties of difluoroboranyl 2-oxoacetate?
difluoroboranyl 2-oxoacetate has a molecular weight of 121.83 g/mol, XLogP of -0.35, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for difluoroboranyl 2-oxoacetate is sourced from PubChem (CID 170546863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).