C16H24N4O2 — CID 170547609
(8aS)-2-[3-[(2-oxopyrrolidin-1-yl)methyl]-1-bicyclo[1.1.1]pentanyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 170547609) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (8aS)-2-[3-[(2-oxopyrrolidin-1-yl)methyl]-1-bicyclo[1.1.1]pentanyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | (8aS)-2-[3-[(2-oxopyrrolidin-1-yl)methyl]-1-bicyclo[1.1.1]pentanyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 170547609 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (8aS)-2-[3-[(2-oxopyrrolidin-1-yl)methyl]-1-bicyclo[1.1.1]pentanyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | O=C1CCCN1CC12CC(N3C[C@@H]4CNCCN4C3=O)(C1)C2 |
| InChI | InChI=1S/C16H24N4O2/c21-13-2-1-4-18(13)11-15-8-16(9-15,10-15)20-7-12-6-17-3-5-19(12)14(20)22/h12,17H,1-11H2/t12-,15?,16?/m0/s1 |
| InChIKey | BAUYUSWWHZTIIU-JQRITLKVSA-N |
| XLogP | 0.24 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |