C15H24BN3O3Si — CID 170547677
[5-[1-[tert-butyl(dimethyl)silyl]oxycyclopropyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]boronic acid (PubChem CID 170547677) has the molecular formula C15H24BN3O3Si and a molecular weight of 333.27 g/mol. Its IUPAC name is [5-[1-[tert-butyl(dimethyl)silyl]oxycyclopropyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]boronic acid.
| Compound Name | [5-[1-[tert-butyl(dimethyl)silyl]oxycyclopropyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]boronic acid |
|---|---|
| PubChem CID | 170547677 |
| Molecular Formula | C15H24BN3O3Si |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | [5-[1-[tert-butyl(dimethyl)silyl]oxycyclopropyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]boronic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1(c2ccc(B(O)O)c3ncnn23)CC1 |
| InChI | InChI=1S/C15H24BN3O3Si/c1-14(2,3)23(4,5)22-15(8-9-15)12-7-6-11(16(20)21)13-17-10-18-19(12)13/h6-7,10,20-21H,8-9H2,1-5H3 |
| InChIKey | WKXGDTMJYUWVEU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|